Isoindoline

Isoindoline

Names
Preferred IUPAC name 2,3-Dihydro-1H-isoindole
Identifiers
CAS Number	496-12-8 [1]
3D model (JSmol)	Interactive image
ChemSpider	373951
ECHA InfoCard	100.156.955
PubChem CID	422478
CompTox Dashboard (EPA)	DTXSID20964291
InChI InChI=1S/C8H9N/c1-2-4-8-6-9-5-7(8)3-1/h1-4,9H,5-6H2 Key: GWVMLCQWXVFZCN-UHFFFAOYSA-N InChI=1/C8H9N/c1-2-4-8-6-9-5-7(8)3-1/h1-4,9H,5-6H2 Key: GWVMLCQWXVFZCN-UHFFFAOYAS
SMILES c1cccc2c1CNC2
Properties
Chemical formula	C8H9N
Molar mass	119.167 g·mol−1
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). Y verify (what is YN ?) Infobox references

Isoindoline is a heterocyclic organic compound with the molecular formula C₈H₉N.^[2] The parent compound has a bicyclic structure, consisting of a six-membered benzene ring fused to a five-membered nitrogen-containing ring. The compound's structure is similar to indoline except that the nitrogen atom is in the 2 position instead of the 1 position of the five-membered ring. Isoindoline itself is not commonly encountered, but several derivatives are found in nature and some synthetic derivatives are commercially valuable drugs, e.g. pazinaclone.^[3]